C10H16ClN3S — CID 65282387
3-chloro-4-(4,4-dimethylazepan-1-yl)-1,2,5-thiadiazole (PubChem CID 65282387) has the molecular formula C10H16ClN3S and a molecular weight of 245.78 g/mol. Its IUPAC name is 3-chloro-4-(4,4-dimethylazepan-1-yl)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(4,4-dimethylazepan-1-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 65282387 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-chloro-4-(4,4-dimethylazepan-1-yl)-1,2,5-thiadiazole |
| SMILES | CC1(C)CCCN(c2nsnc2Cl)CC1 |
| InChI | InChI=1S/C10H16ClN3S/c1-10(2)4-3-6-14(7-5-10)9-8(11)12-15-13-9/h3-7H2,1-2H3 |
| InChIKey | VJBGLKARXXRGAW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |