C15H26N2O3S — CID 107406919
3-amino-2,5-diethyl-N-(2-methoxy-2-methylpropyl)benzenesulfonamide (PubChem CID 107406919) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-amino-2,5-diethyl-N-(2-methoxy-2-methylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-2,5-diethyl-N-(2-methoxy-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107406919 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-amino-2,5-diethyl-N-(2-methoxy-2-methylpropyl)benzenesulfonamide |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)NCC(C)(C)OC)c1 |
| InChI | InChI=1S/C15H26N2O3S/c1-6-11-8-13(16)12(7-2)14(9-11)21(18,19)17-10-15(3,4)20-5/h8-9,17H,6-7,10,16H2,1-5H3 |
| InChIKey | IENFKOXGONUSDY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|