C16H28N2O2S — CID 107407026
3-amino-N-(3,3-dimethylbutyl)-2,5-diethylbenzenesulfonamide (PubChem CID 107407026) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-amino-N-(3,3-dimethylbutyl)-2,5-diethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(3,3-dimethylbutyl)-2,5-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107407026 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 3-amino-N-(3,3-dimethylbutyl)-2,5-diethylbenzenesulfonamide |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)NCCC(C)(C)C)c1 |
| InChI | InChI=1S/C16H28N2O2S/c1-6-12-10-14(17)13(7-2)15(11-12)21(19,20)18-9-8-16(3,4)5/h10-11,18H,6-9,17H2,1-5H3 |
| InChIKey | NJLGTJACFMWSBK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|