C14H22N2O3S — CID 107407018
3-amino-2,5-diethyl-N-[1-(hydroxymethyl)cyclopropyl]benzenesulfonamide (PubChem CID 107407018) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-amino-2,5-diethyl-N-[1-(hydroxymethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 3-amino-2,5-diethyl-N-[1-(hydroxymethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107407018 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-amino-2,5-diethyl-N-[1-(hydroxymethyl)cyclopropyl]benzenesulfonamide |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)NC2(CO)CC2)c1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-10-7-12(15)11(4-2)13(8-10)20(18,19)16-14(9-17)5-6-14/h7-8,16-17H,3-6,9,15H2,1-2H3 |
| InChIKey | NLFDFXPGLAGFPN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|