About 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine
2-(3-amino-2,5-diethylphenyl)sulfonylguanidine (PubChem CID 107407059) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine.
Molecular Properties
| Compound Name | 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine |
| PubChem CID | 107407059 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)N=C(N)N)c1 |
| InChI | InChI=1S/C11H18N4O2S/c1-3-7-5-9(12)8(4-2)10(6-7)18(16,17)15-11(13)14/h5-6H,3-4,12H2,1-2H3,(H4,13,14,15) |
| InChIKey | SGUWHQRIFAITQD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine?
The IUPAC name of 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine (CID 107407059) is 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine.
What is the SMILES notation for 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine?
The canonical SMILES for 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine is CCc1cc(N)c(CC)c(S(=O)(=O)N=C(N)N)c1.
What is the InChIKey of 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine?
The InChIKey is SGUWHQRIFAITQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-3-7-5-9(12)8(4-2)10(6-7)18(16,17)15-11(13)14/h5-6H,3-4,12H2,1-2H3,(H4,13,14,15).
What are the key properties of 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine?
2-(3-amino-2,5-diethylphenyl)sulfonylguanidine has a molecular weight of 270.36 g/mol, XLogP of 0.36, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-2,5-diethylphenyl)sulfonylguanidine is sourced from PubChem (CID 107407059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).