C18H13F7N2O2 — CID 10740892
2-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-1-(4-methoxyphenyl)benzimidazole (PubChem CID 10740892) has the molecular formula C18H13F7N2O2 and a molecular weight of 422.30 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-1-(4-methoxyphenyl)benzimidazole.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-1-(4-methoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 10740892 |
| Molecular Formula | C18H13F7N2O2 |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methoxy-1-(4-methoxyphenyl)benzimidazole |
| SMILES | COc1ccc(-n2c(C(F)(F)C(F)(F)C(F)(F)F)nc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C18H13F7N2O2/c1-28-11-5-3-10(4-6-11)27-14-9-12(29-2)7-8-13(14)26-15(27)16(19,20)17(21,22)18(23,24)25/h3-9H,1-2H3 |
| InChIKey | FCTQQLRIFYKQHC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|