C22H17F5N3O+ — CID 59296701
(2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium (PubChem CID 59296701) has the molecular formula C22H17F5N3O+ and a molecular weight of 434.39 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium.
| Compound Name | (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium |
|---|---|
| PubChem CID | 59296701 |
| Molecular Formula | C22H17F5N3O+ |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium |
| SMILES | COc1ccc2c(c1)nc(C(F)(F)F)n2-c1ccc([NH2+]Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C22H16F5N3O/c1-31-15-9-10-20-19(11-15)29-21(22(25,26)27)30(20)14-7-5-13(6-8-14)28-12-16-17(23)3-2-4-18(16)24/h2-11,28H,12H2,1H3/p+1 |
| InChIKey | NYZSHNWJMOVYHJ-UHFFFAOYSA-O |
| XLogP | 4.73 |
| TPSA | 43.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|