C28H22F5N3O4S — CID 159072970
(2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium;oxidoperoxysulfanylbenzene (PubChem CID 159072970) has the molecular formula C28H22F5N3O4S and a molecular weight of 591.56 g/mol. Its IUPAC name is (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium;oxidoperoxysulfanylbenzene.
| Compound Name | (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium;oxidoperoxysulfanylbenzene |
|---|---|
| PubChem CID | 159072970 |
| Molecular Formula | C28H22F5N3O4S |
| Molecular Weight | 591.56 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | (2,6-difluorophenyl)methyl-[4-[5-methoxy-2-(trifluoromethyl)benzimidazol-1-yl]phenyl]azanium;oxidoperoxysulfanylbenzene |
| SMILES | COc1ccc2c(c1)nc(C(F)(F)F)n2-c1ccc([NH2+]Cc2c(F)cccc2F)cc1.[O-]OOSc1ccccc1 |
| InChI | InChI=1S/C22H16F5N3O.C6H6O3S/c1-31-15-9-10-20-19(11-15)29-21(22(25,26)27)30(20)14-7-5-13(6-8-14)28-12-16-17(23)3-2-4-18(16)24;7-8-9-10-6-4-2-1-3-5-6/h2-11,28H,12H2,1H3;1-5,7H |
| InChIKey | JZWYKEXMWYWKCQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|