C15H23N5O — CID 107409030
1-[6-(ethylamino)imidazo[1,2-a]pyrazin-8-yl]-4-methylazepan-4-ol (PubChem CID 107409030) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[6-(ethylamino)imidazo[1,2-a]pyrazin-8-yl]-4-methylazepan-4-ol.
| Compound Name | 1-[6-(ethylamino)imidazo[1,2-a]pyrazin-8-yl]-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107409030 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[6-(ethylamino)imidazo[1,2-a]pyrazin-8-yl]-4-methylazepan-4-ol |
| SMILES | CCNc1cn2ccnc2c(N2CCCC(C)(O)CC2)n1 |
| InChI | InChI=1S/C15H23N5O/c1-3-16-12-11-20-10-7-17-13(20)14(18-12)19-8-4-5-15(2,21)6-9-19/h7,10-11,16,21H,3-6,8-9H2,1-2H3 |
| InChIKey | VRTJQECXTZGUPB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |