About (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate
(2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate (PubChem CID 10740944) has the molecular formula C22H19BrN2O2
and a molecular weight of 423.31 g/mol. Its IUPAC name is (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate.
Molecular Properties
| Compound Name | (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate |
| PubChem CID | 10740944 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate |
| SMILES | O=C(/C=N/N(c1ccccc1)c1ccccc1)OCC(Br)c1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O2/c23-21(18-10-4-1-5-11-18)17-27-22(26)16-24-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-16,21H,17H2/b24-16+ |
| InChIKey | FZRSTVNUXXEEBU-LFVJCYFKSA-N |
| XLogP | 5.49 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate?
The IUPAC name of (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate (CID 10740944) is (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate.
What is the SMILES notation for (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate?
The canonical SMILES for (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate is O=C(/C=N/N(c1ccccc1)c1ccccc1)OCC(Br)c1ccccc1.
What is the InChIKey of (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate?
The InChIKey is FZRSTVNUXXEEBU-LFVJCYFKSA-N. The full InChI is InChI=1S/C22H19BrN2O2/c23-21(18-10-4-1-5-11-18)17-27-22(26)16-24-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-16,21H,17H2/b24-16+.
What are the key properties of (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate?
(2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate has a molecular weight of 423.31 g/mol, XLogP of 5.49, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-2-phenylethyl) (2E)-2-(diphenylhydrazinylidene)acetate is sourced from PubChem (CID 10740944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).