3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid

C13H9N3O3 — CID 107410226

IUPAC3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid
SMILESO=C(O)c1cc2ccccc2cc1-n1cn[nH]c1=O
InChIInChI=1S/C13H9N3O3/c17-12(18)10-5-8-3-1-2-4-9(8)6-11(10)16-7-14-15-13(16)19/h1-7H,(H,15,19)(H,17,18)
InChIKeyNFMWAWFEFLWSBU-UHFFFAOYSA-N
MW255.23 g/mol
LogP1.41
Rot. Bonds2

About 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid

3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid (PubChem CID 107410226) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid.

Molecular Properties

Compound Name3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid
PubChem CID107410226
Molecular FormulaC13H9N3O3
Molecular Weight255.23 g/mol
Exact Mass255.06
IUPAC Name3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid
SMILESO=C(O)c1cc2ccccc2cc1-n1cn[nH]c1=O
InChIInChI=1S/C13H9N3O3/c17-12(18)10-5-8-3-1-2-4-9(8)6-11(10)16-7-14-15-13(16)19/h1-7H,(H,15,19)(H,17,18)
InChIKeyNFMWAWFEFLWSBU-UHFFFAOYSA-N
XLogP1.41
TPSA87.98 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.23
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid?
The IUPAC name of 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid (CID 107410226) is 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid.
What is the SMILES notation for 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid?
The canonical SMILES for 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid is O=C(O)c1cc2ccccc2cc1-n1cn[nH]c1=O.
What is the InChIKey of 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid?
The InChIKey is NFMWAWFEFLWSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3/c17-12(18)10-5-8-3-1-2-4-9(8)6-11(10)16-7-14-15-13(16)19/h1-7H,(H,15,19)(H,17,18).
What are the key properties of 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid?
3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid has a molecular weight of 255.23 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-oxo-1H-1,2,4-triazol-4-yl)naphthalene-2-carboxylic acid is sourced from PubChem (CID 107410226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).