2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid

C7H5N3O3S — CID 107410233

IUPAC2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1-n1cn[nH]c1=O
InChIInChI=1S/C7H5N3O3S/c11-6(12)4-1-2-14-5(4)10-3-8-9-7(10)13/h1-3H,(H,9,13)(H,11,12)
InChIKeyAGPRKJUNIKCZAR-UHFFFAOYSA-N
MW211.20 g/mol
LogP0.32
Rot. Bonds2

About 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid

2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid (PubChem CID 107410233) has the molecular formula C7H5N3O3S and a molecular weight of 211.20 g/mol. Its IUPAC name is 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid
PubChem CID107410233
Molecular FormulaC7H5N3O3S
Molecular Weight211.20 g/mol
Exact Mass211.01
IUPAC Name2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1-n1cn[nH]c1=O
InChIInChI=1S/C7H5N3O3S/c11-6(12)4-1-2-14-5(4)10-3-8-9-7(10)13/h1-3H,(H,9,13)(H,11,12)
InChIKeyAGPRKJUNIKCZAR-UHFFFAOYSA-N
XLogP0.32
TPSA87.98 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.20
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid?
The IUPAC name of 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid (CID 107410233) is 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid.
What is the SMILES notation for 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid?
The canonical SMILES for 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid is O=C(O)c1ccsc1-n1cn[nH]c1=O.
What is the InChIKey of 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid?
The InChIKey is AGPRKJUNIKCZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3S/c11-6(12)4-1-2-14-5(4)10-3-8-9-7(10)13/h1-3H,(H,9,13)(H,11,12).
What are the key properties of 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid?
2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid has a molecular weight of 211.20 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1H-1,2,4-triazol-4-yl)thiophene-3-carboxylic acid is sourced from PubChem (CID 107410233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).