2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid

C7H5N3O4S — CID 107409403

IUPAC2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1-n1c(=O)[nH][nH]c1=O
InChIInChI=1S/C7H5N3O4S/c11-5(12)3-1-2-15-4(3)10-6(13)8-9-7(10)14/h1-2H,(H,8,13)(H,9,14)(H,11,12)
InChIKeyFXCIWFBUTASLKI-UHFFFAOYSA-N
MW227.20 g/mol
LogP-0.39
Rot. Bonds2

About 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid

2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid (PubChem CID 107409403) has the molecular formula C7H5N3O4S and a molecular weight of 227.20 g/mol. Its IUPAC name is 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid
PubChem CID107409403
Molecular FormulaC7H5N3O4S
Molecular Weight227.20 g/mol
Exact Mass227.00
IUPAC Name2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1-n1c(=O)[nH][nH]c1=O
InChIInChI=1S/C7H5N3O4S/c11-5(12)3-1-2-15-4(3)10-6(13)8-9-7(10)14/h1-2H,(H,8,13)(H,9,14)(H,11,12)
InChIKeyFXCIWFBUTASLKI-UHFFFAOYSA-N
XLogP-0.39
TPSA107.95 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.20
LogP ≤ 5-0.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid?
The IUPAC name of 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid (CID 107409403) is 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid.
What is the SMILES notation for 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid?
The canonical SMILES for 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid is O=C(O)c1ccsc1-n1c(=O)[nH][nH]c1=O.
What is the InChIKey of 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid?
The InChIKey is FXCIWFBUTASLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O4S/c11-5(12)3-1-2-15-4(3)10-6(13)8-9-7(10)14/h1-2H,(H,8,13)(H,9,14)(H,11,12).
What are the key properties of 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid?
2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid has a molecular weight of 227.20 g/mol, XLogP of -0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dioxo-1,2,4-triazolidin-4-yl)thiophene-3-carboxylic acid is sourced from PubChem (CID 107409403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).