2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid

C9H7NO4S2 — CID 104570369

IUPAC2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1N1C(=O)CSCC1=O
InChIInChI=1S/C9H7NO4S2/c11-6-3-15-4-7(12)10(6)8-5(9(13)14)1-2-16-8/h1-2H,3-4H2,(H,13,14)
InChIKeyVJYIQAKBQCRAJG-UHFFFAOYSA-N
MW257.29 g/mol
LogP1.05
Rot. Bonds2

About 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid

2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid (PubChem CID 104570369) has the molecular formula C9H7NO4S2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid
PubChem CID104570369
Molecular FormulaC9H7NO4S2
Molecular Weight257.29 g/mol
Exact Mass256.98
IUPAC Name2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid
SMILESO=C(O)c1ccsc1N1C(=O)CSCC1=O
InChIInChI=1S/C9H7NO4S2/c11-6-3-15-4-7(12)10(6)8-5(9(13)14)1-2-16-8/h1-2H,3-4H2,(H,13,14)
InChIKeyVJYIQAKBQCRAJG-UHFFFAOYSA-N
XLogP1.05
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid?
The IUPAC name of 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid (CID 104570369) is 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid.
What is the SMILES notation for 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid?
The canonical SMILES for 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid is O=C(O)c1ccsc1N1C(=O)CSCC1=O.
What is the InChIKey of 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid?
The InChIKey is VJYIQAKBQCRAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO4S2/c11-6-3-15-4-7(12)10(6)8-5(9(13)14)1-2-16-8/h1-2H,3-4H2,(H,13,14).
What are the key properties of 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid?
2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid has a molecular weight of 257.29 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid is sourced from PubChem (CID 104570369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).