C9H7NO4S2 — CID 104570369
2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid (PubChem CID 104570369) has the molecular formula C9H7NO4S2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 104570369 |
| Molecular Formula | C9H7NO4S2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 2-(3,5-dioxothiomorpholin-4-yl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1N1C(=O)CSCC1=O |
| InChI | InChI=1S/C9H7NO4S2/c11-6-3-15-4-7(12)10(6)8-5(9(13)14)1-2-16-8/h1-2H,3-4H2,(H,13,14) |
| InChIKey | VJYIQAKBQCRAJG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|