C11H14N4O — CID 107410843
4-[2-(ethylaminomethyl)phenyl]-1H-1,2,4-triazol-5-one (PubChem CID 107410843) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-[2-(ethylaminomethyl)phenyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[2-(ethylaminomethyl)phenyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 107410843 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-[2-(ethylaminomethyl)phenyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCNCc1ccccc1-n1cn[nH]c1=O |
| InChI | InChI=1S/C11H14N4O/c1-2-12-7-9-5-3-4-6-10(9)15-8-13-14-11(15)16/h3-6,8,12H,2,7H2,1H3,(H,14,16) |
| InChIKey | RECUOWDDAGAFTE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |