C16H30N2O3 — CID 107414639
4-ethyl-6-[(3-methylcyclopentyl)methylcarbamoylamino]hexanoic acid (PubChem CID 107414639) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-ethyl-6-[(3-methylcyclopentyl)methylcarbamoylamino]hexanoic acid.
| Compound Name | 4-ethyl-6-[(3-methylcyclopentyl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107414639 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 4-ethyl-6-[(3-methylcyclopentyl)methylcarbamoylamino]hexanoic acid |
| SMILES | CCC(CCNC(=O)NCC1CCC(C)C1)CCC(=O)O |
| InChI | InChI=1S/C16H30N2O3/c1-3-13(6-7-15(19)20)8-9-17-16(21)18-11-14-5-4-12(2)10-14/h12-14H,3-11H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | DOWUMTSEALCSNI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |