About CID 10741471
CID 10741471 (PubChem CID 10741471) has the molecular formula C20H29FeNOSe+2
and a molecular weight of 434.26 g/mol.
Molecular Properties
| Compound Name | CID 10741471 |
| PubChem CID | 10741471 |
| Molecular Formula | C20H29FeNOSe+2 |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | — |
| SMILES | CCC1OCC[C@H]1[Se][C]1[CH][CH][CH][C]1[C@@H](C)N(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C15H24NOSe.C5H5.Fe/c1-5-13-15(9-10-17-13)18-14-8-6-7-12(14)11(2)16(3)4;1-2-4-5-3-1;/h6-8,11,13,15H,5,9-10H2,1-4H3;1-5H;/q;;+2/t11-,13?,15-;;/m1../s1 |
| InChIKey | MPCTZBUVNXNAFA-BIMRFFIKSA-N |
| XLogP | 3.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10741471 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10741471?
The IUPAC name of CID 10741471 (CID 10741471) is not available.
What is the SMILES notation for CID 10741471?
The canonical SMILES for CID 10741471 is CCC1OCC[C@H]1[Se][C]1[CH][CH][CH][C]1[C@@H](C)N(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10741471?
The InChIKey is MPCTZBUVNXNAFA-BIMRFFIKSA-N. The full InChI is InChI=1S/C15H24NOSe.C5H5.Fe/c1-5-13-15(9-10-17-13)18-14-8-6-7-12(14)11(2)16(3)4;1-2-4-5-3-1;/h6-8,11,13,15H,5,9-10H2,1-4H3;1-5H;/q;;+2/t11-,13?,15-;;/m1../s1.
What are the key properties of CID 10741471?
CID 10741471 has a molecular weight of 434.26 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10741471 is sourced from PubChem (CID 10741471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).