C24H42O5Si — CID 10741682
(3R)-3-[(3E,5S,8E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)-5-methyldeca-3,8-dien-5-yl]oxolan-2-one (PubChem CID 10741682) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (3R)-3-[(3E,5S,8E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)-5-methyldeca-3,8-dien-5-yl]oxolan-2-one.
| Compound Name | (3R)-3-[(3E,5S,8E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)-5-methyldeca-3,8-dien-5-yl]oxolan-2-one |
|---|---|
| PubChem CID | 10741682 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (3R)-3-[(3E,5S,8E)-1-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)-5-methyldeca-3,8-dien-5-yl]oxolan-2-one |
| SMILES | C/C(=C\CC[C@@](C)(/C=C/CCO[Si](C)(C)C(C)(C)C)[C@H]1CCOC1=O)C1OCCO1 |
| InChI | InChI=1S/C24H42O5Si/c1-19(22-27-17-18-28-22)11-10-14-24(5,20-12-16-26-21(20)25)13-8-9-15-29-30(6,7)23(2,3)4/h8,11,13,20,22H,9-10,12,14-18H2,1-7H3/b13-8+,19-11+/t20-,24+/m0/s1 |
| InChIKey | SETMDDCEZVSEQJ-QGTDTTMHSA-N |
| XLogP | 5.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|