C26H22N2O5 — CID 10741852
ethyl (2R,7R,8S,9S)-4,6-dioxo-5-phenyl-11-oxa-3,5-diazapentacyclo[10.8.0.02,9.03,7.015,20]icosa-1(12),13,15,17,19-pentaene-8-carboxylate (PubChem CID 10741852) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is ethyl (2R,7R,8S,9S)-4,6-dioxo-5-phenyl-11-oxa-3,5-diazapentacyclo[10.8.0.02,9.03,7.015,20]icosa-1(12),13,15,17,19-pentaene-8-carboxylate.
| Compound Name | ethyl (2R,7R,8S,9S)-4,6-dioxo-5-phenyl-11-oxa-3,5-diazapentacyclo[10.8.0.02,9.03,7.015,20]icosa-1(12),13,15,17,19-pentaene-8-carboxylate |
|---|---|
| PubChem CID | 10741852 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl (2R,7R,8S,9S)-4,6-dioxo-5-phenyl-11-oxa-3,5-diazapentacyclo[10.8.0.02,9.03,7.015,20]icosa-1(12),13,15,17,19-pentaene-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2COc3ccc4ccccc4c3[C@@H]2N2C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C26H22N2O5/c1-2-32-25(30)21-18-14-33-19-13-12-15-8-6-7-11-17(15)20(19)22(18)28-23(21)24(29)27(26(28)31)16-9-4-3-5-10-16/h3-13,18,21-23H,2,14H2,1H3/t18-,21-,22+,23+/m0/s1 |
| InChIKey | LXDZQMVBJLHPRD-XSEFMFLKSA-N |
| XLogP | 3.92 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|