C13H26N2 — CID 107420452
6-methyl-1-[(2-methylcyclopentyl)methyl]-1,4-diazepane (PubChem CID 107420452) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 6-methyl-1-[(2-methylcyclopentyl)methyl]-1,4-diazepane.
| Compound Name | 6-methyl-1-[(2-methylcyclopentyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 107420452 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 6-methyl-1-[(2-methylcyclopentyl)methyl]-1,4-diazepane |
| SMILES | CC1CNCCN(CC2CCCC2C)C1 |
| InChI | InChI=1S/C13H26N2/c1-11-8-14-6-7-15(9-11)10-13-5-3-4-12(13)2/h11-14H,3-10H2,1-2H3 |
| InChIKey | VNWKMUCFQSPOOY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |