C16H33N3 — CID 175833983
1-(cyclopentylmethyl)-3-methyl-1,5,9-triazacyclododecane (PubChem CID 175833983) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-3-methyl-1,5,9-triazacyclododecane.
| Compound Name | 1-(cyclopentylmethyl)-3-methyl-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 175833983 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | 1-(cyclopentylmethyl)-3-methyl-1,5,9-triazacyclododecane |
| SMILES | CC1CNCCCNCCCN(CC2CCCC2)C1 |
| InChI | InChI=1S/C16H33N3/c1-15-12-18-9-4-8-17-10-5-11-19(13-15)14-16-6-2-3-7-16/h15-18H,2-14H2,1H3 |
| InChIKey | XMRYJTZDBVLSDU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |