C8H17N3O4S — CID 107423314
ethyl N-[(3-methylpyrrolidin-3-yl)sulfamoyl]carbamate (PubChem CID 107423314) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl N-[(3-methylpyrrolidin-3-yl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(3-methylpyrrolidin-3-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107423314 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | ethyl N-[(3-methylpyrrolidin-3-yl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NC1(C)CCNC1 |
| InChI | InChI=1S/C8H17N3O4S/c1-3-15-7(12)10-16(13,14)11-8(2)4-5-9-6-8/h9,11H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | ADPPWHLJLGKCMR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |