C13H19N3O5 — CID 107423415
2-[2-(dimethylamino)ethyl-[2-(furan-2-carbonylamino)acetyl]amino]acetic acid (PubChem CID 107423415) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-[2-(furan-2-carbonylamino)acetyl]amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-[2-(furan-2-carbonylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 107423415 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-[2-(furan-2-carbonylamino)acetyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)C(=O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H19N3O5/c1-15(2)5-6-16(9-12(18)19)11(17)8-14-13(20)10-4-3-7-21-10/h3-4,7H,5-6,8-9H2,1-2H3,(H,14,20)(H,18,19) |
| InChIKey | PEKORHKLKJIGBM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |