C9H11F3N2O4 — CID 107427404
5-(4,4,4-trifluorobutylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107427404) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(4,4,4-trifluorobutylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107427404 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-(4,4,4-trifluorobutylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)NCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H11F3N2O4/c10-9(11,12)2-1-3-13-7(15)6-4-5(8(16)17)14-18-6/h6H,1-4H2,(H,13,15)(H,16,17) |
| InChIKey | GWJUQPMSKSEQTK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|