C9H11F3N2O5 — CID 107427219
5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107427219) has the molecular formula C9H11F3N2O5 and a molecular weight of 284.19 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107427219 |
| Molecular Formula | C9H11F3N2O5 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)ethylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H11F3N2O5/c10-9(11,12)4-18-2-1-13-7(15)6-3-5(8(16)17)14-19-6/h6H,1-4H2,(H,13,15)(H,16,17) |
| InChIKey | SXMZMESJABEQQY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|