C10H13F3N2O4 — CID 107427405
5-(5,5,5-trifluoropentylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107427405) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 5-(5,5,5-trifluoropentylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(5,5,5-trifluoropentylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107427405 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-(5,5,5-trifluoropentylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)NCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H13F3N2O4/c11-10(12,13)3-1-2-4-14-8(16)7-5-6(9(17)18)15-19-7/h7H,1-5H2,(H,14,16)(H,17,18) |
| InChIKey | YECNYYBJBNZADI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|