C15H23N5 — CID 107431163
N-[(3,5-diethyl-1-pyrazin-2-ylpyrazol-4-yl)methyl]propan-1-amine (PubChem CID 107431163) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(3,5-diethyl-1-pyrazin-2-ylpyrazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(3,5-diethyl-1-pyrazin-2-ylpyrazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107431163 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | N-[(3,5-diethyl-1-pyrazin-2-ylpyrazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1c(CC)nn(-c2cnccn2)c1CC |
| InChI | InChI=1S/C15H23N5/c1-4-7-16-10-12-13(5-2)19-20(14(12)6-3)15-11-17-8-9-18-15/h8-9,11,16H,4-7,10H2,1-3H3 |
| InChIKey | MJBYZAFUNRHERK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|