C14H25N7 — CID 107053736
N-[[3,5-diethyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 107053736) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-[[3,5-diethyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-diethyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107053736 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[[3,5-diethyl-1-[(2-methyltetrazol-5-yl)methyl]pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c(CC)nn(Cc2nnn(C)n2)c1CC |
| InChI | InChI=1S/C14H25N7/c1-5-8-15-9-11-12(6-2)17-21(13(11)7-3)10-14-16-19-20(4)18-14/h15H,5-10H2,1-4H3 |
| InChIKey | JADCQWPVHUHZPF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|