C14H24F3N3S — CID 116617998
N-[[3,5-diethyl-1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-4-yl]methyl]propan-1-amine (PubChem CID 116617998) has the molecular formula C14H24F3N3S and a molecular weight of 323.43 g/mol. Its IUPAC name is N-[[3,5-diethyl-1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3,5-diethyl-1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 116617998 |
| Molecular Formula | C14H24F3N3S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[[3,5-diethyl-1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c(CC)nn(CCSC(F)(F)F)c1CC |
| InChI | InChI=1S/C14H24F3N3S/c1-4-7-18-10-11-12(5-2)19-20(13(11)6-3)8-9-21-14(15,16)17/h18H,4-10H2,1-3H3 |
| InChIKey | GZSCBJQBZCYSKV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|