C10H15N7O — CID 107067014
2-[(2-methyltetrazol-5-yl)methyl]-5-(propylamino)pyridazin-3-one (PubChem CID 107067014) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methyl]-5-(propylamino)pyridazin-3-one.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methyl]-5-(propylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 107067014 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methyl]-5-(propylamino)pyridazin-3-one |
| SMILES | CCCNc1cnn(Cc2nnn(C)n2)c(=O)c1 |
| InChI | InChI=1S/C10H15N7O/c1-3-4-11-8-5-10(18)17(12-6-8)7-9-13-15-16(2)14-9/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | YOUBETOVLBSXGP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |