C12H21N3O2 — CID 103220306
2-(3-hydroxy-3-methylbutyl)-5-(propylamino)pyridazin-3-one (PubChem CID 103220306) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylbutyl)-5-(propylamino)pyridazin-3-one.
| Compound Name | 2-(3-hydroxy-3-methylbutyl)-5-(propylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103220306 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-(3-hydroxy-3-methylbutyl)-5-(propylamino)pyridazin-3-one |
| SMILES | CCCNc1cnn(CCC(C)(C)O)c(=O)c1 |
| InChI | InChI=1S/C12H21N3O2/c1-4-6-13-10-8-11(16)15(14-9-10)7-5-12(2,3)17/h8-9,13,17H,4-7H2,1-3H3 |
| InChIKey | BYUCBPAGNJLEOU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |