C16H21N3O — CID 103220165
2-[(2,6-dimethylphenyl)methyl]-5-(propylamino)pyridazin-3-one (PubChem CID 103220165) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)methyl]-5-(propylamino)pyridazin-3-one.
| Compound Name | 2-[(2,6-dimethylphenyl)methyl]-5-(propylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103220165 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)methyl]-5-(propylamino)pyridazin-3-one |
| SMILES | CCCNc1cnn(Cc2c(C)cccc2C)c(=O)c1 |
| InChI | InChI=1S/C16H21N3O/c1-4-8-17-14-9-16(20)19(18-10-14)11-15-12(2)6-5-7-13(15)3/h5-7,9-10,17H,4,8,11H2,1-3H3 |
| InChIKey | MYSZMTFZEGPXET-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |