C10H17N7 — CID 107054678
N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]propan-1-amine (PubChem CID 107054678) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107054678 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnn1Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H17N7/c1-3-5-11-7-9-4-6-12-17(9)8-10-13-15-16(2)14-10/h4,6,11H,3,5,7-8H2,1-2H3 |
| InChIKey | HEBPFLYQOYFBOU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|