C10H17N7O — CID 107054683
2-methoxy-N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]ethanamine (PubChem CID 107054683) has the molecular formula C10H17N7O and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methoxy-N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107054683 |
| Molecular Formula | C10H17N7O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-methoxy-N-[[2-[(2-methyltetrazol-5-yl)methyl]pyrazol-3-yl]methyl]ethanamine |
| SMILES | COCCNCc1ccnn1Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H17N7O/c1-16-14-10(13-15-16)8-17-9(3-4-12-17)7-11-5-6-18-2/h3-4,11H,5-8H2,1-2H3 |
| InChIKey | GIOFCMWNNAGOEZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|