C26H32Cl2N2O2 — CID 10743171
2-(3,4-dichlorophenyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one (PubChem CID 10743171) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-(3,4-dichlorophenyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10743171 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-[5-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pentyl]-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2ccc(Cl)c(Cl)c2)Oc2ccccc21 |
| InChI | InChI=1S/C26H32Cl2N2O2/c1-18-9-8-10-19(2)29(18)15-6-3-7-16-30-23-11-4-5-12-24(23)32-25(26(30)31)20-13-14-21(27)22(28)17-20/h4-5,11-14,17-19,25H,3,6-10,15-16H2,1-2H3/t18-,19+,25? |
| InChIKey | WMQKPPPXTMEXKK-OOEJVQDLSA-N |
| XLogP | 6.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|