C17H24O3S — CID 107431950
2-(2-cyclohexyl-1-hydroxycyclohexyl)thiophene-3-carboxylic acid (PubChem CID 107431950) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1-hydroxycyclohexyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(2-cyclohexyl-1-hydroxycyclohexyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107431950 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(2-cyclohexyl-1-hydroxycyclohexyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1C1(O)CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C17H24O3S/c18-16(19)13-9-11-21-15(13)17(20)10-5-4-8-14(17)12-6-2-1-3-7-12/h9,11-12,14,20H,1-8,10H2,(H,18,19) |
| InChIKey | YKHZXHNAZISZLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |