C14H13FO3S — CID 107432653
2-[1-(4-fluorophenyl)-2-hydroxypropan-2-yl]thiophene-3-carboxylic acid (PubChem CID 107432653) has the molecular formula C14H13FO3S and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-2-hydroxypropan-2-yl]thiophene-3-carboxylic acid.
| Compound Name | 2-[1-(4-fluorophenyl)-2-hydroxypropan-2-yl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107432653 |
| Molecular Formula | C14H13FO3S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-2-hydroxypropan-2-yl]thiophene-3-carboxylic acid |
| SMILES | CC(O)(Cc1ccc(F)cc1)c1sccc1C(=O)O |
| InChI | InChI=1S/C14H13FO3S/c1-14(18,8-9-2-4-10(15)5-3-9)12-11(13(16)17)6-7-19-12/h2-7,18H,8H2,1H3,(H,16,17) |
| InChIKey | BLFXBYYPFSSVTC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |