C10H12FNO2 — CID 114834276
3-(4-fluorophenyl)-2-hydroxy-2-methylpropanamide (PubChem CID 114834276) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-hydroxy-2-methylpropanamide.
| Compound Name | 3-(4-fluorophenyl)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 114834276 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 3-(4-fluorophenyl)-2-hydroxy-2-methylpropanamide |
| SMILES | CC(O)(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C10H12FNO2/c1-10(14,9(12)13)6-7-2-4-8(11)5-3-7/h2-5,14H,6H2,1H3,(H2,12,13) |
| InChIKey | JSESIHAGSNBZCI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |