C11H12F3NO — CID 67372008
4,4-difluoro-5-(4-fluorophenyl)pentanamide (PubChem CID 67372008) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 4,4-difluoro-5-(4-fluorophenyl)pentanamide.
| Compound Name | 4,4-difluoro-5-(4-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 67372008 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4,4-difluoro-5-(4-fluorophenyl)pentanamide |
| SMILES | NC(=O)CCC(F)(F)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12F3NO/c12-9-3-1-8(2-4-9)7-11(13,14)6-5-10(15)16/h1-4H,5-7H2,(H2,15,16) |
| InChIKey | SMNWQXKSCUJGEF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |