C22H26N2O6S2 — CID 10743281
(1S,5R)-3-(benzenesulfonyl)-8-(4-methylphenyl)sulfonyl-2-(1-nitroethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 10743281) has the molecular formula C22H26N2O6S2 and a molecular weight of 478.59 g/mol. Its IUPAC name is (1S,5R)-3-(benzenesulfonyl)-8-(4-methylphenyl)sulfonyl-2-(1-nitroethyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-(benzenesulfonyl)-8-(4-methylphenyl)sulfonyl-2-(1-nitroethyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 10743281 |
| Molecular Formula | C22H26N2O6S2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | (1S,5R)-3-(benzenesulfonyl)-8-(4-methylphenyl)sulfonyl-2-(1-nitroethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3CC[C@H]2C(C(C)[N+](=O)[O-])C(S(=O)(=O)c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C22H26N2O6S2/c1-15-8-11-19(12-9-15)32(29,30)23-17-10-13-20(23)22(16(2)24(25)26)21(14-17)31(27,28)18-6-4-3-5-7-18/h3-9,11-12,16-17,20-22H,10,13-14H2,1-2H3/t16?,17-,20+,21?,22?/m1/s1 |
| InChIKey | HFNKWSSEAPGSBU-QXQSJWNASA-N |
| XLogP | 3.04 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|