C19H20N2O4S2 — CID 164681374
(3S)-1-(4-methylphenyl)sulfonyl-5-nitro-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 164681374) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S)-1-(4-methylphenyl)sulfonyl-5-nitro-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | (3S)-1-(4-methylphenyl)sulfonyl-5-nitro-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 164681374 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (3S)-1-(4-methylphenyl)sulfonyl-5-nitro-3-prop-1-en-2-yl-4-thiophen-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C=C(C)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)CC([N+](=O)[O-])=C1c1cccs1 |
| InChI | InChI=1S/C19H20N2O4S2/c1-13(2)16-11-20(27(24,25)15-8-6-14(3)7-9-15)12-17(21(22)23)19(16)18-5-4-10-26-18/h4-10,16H,1,11-12H2,2-3H3/t16-/m0/s1 |
| InChIKey | FARUNTYJUGXKDE-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|