C17H18N2O2S2 — CID 15518926
(2S,3R,4S)-N,N-dimethyl-3-nitro-2-phenyl-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 15518926) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (2S,3R,4S)-N,N-dimethyl-3-nitro-2-phenyl-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2S,3R,4S)-N,N-dimethyl-3-nitro-2-phenyl-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 15518926 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (2S,3R,4S)-N,N-dimethyl-3-nitro-2-phenyl-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | CN(C)[C@H]1C=C(c2cccs2)S[C@@H](c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O2S2/c1-18(2)13-11-15(14-9-6-10-22-14)23-17(16(13)19(20)21)12-7-4-3-5-8-12/h3-11,13,16-17H,1-2H3/t13-,16+,17-/m0/s1 |
| InChIKey | SDLJCWMZFOAZJL-XKQJLSEDSA-N |
| XLogP | 4.15 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|