C19H20N2O2S — CID 14666821
(2R,3S,4R)-N,N-dimethyl-3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 14666821) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (2R,3S,4R)-N,N-dimethyl-3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2R,3S,4R)-N,N-dimethyl-3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 14666821 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (2R,3S,4R)-N,N-dimethyl-3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | CN(C)[C@@H]1C=C(c2ccccc2)S[C@H](c2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O2S/c1-20(2)16-13-17(14-9-5-3-6-10-14)24-19(18(16)21(22)23)15-11-7-4-8-12-15/h3-13,16,18-19H,1-2H3/t16-,18+,19-/m1/s1 |
| InChIKey | QBFFHKGKLSRQMH-NZSAHSFTSA-N |
| XLogP | 4.09 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|