C23H21FN2O2S — CID 11890939
(2R,3R,4S)-6-(4-fluorophenyl)-N,N-dimethyl-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 11890939) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R,3R,4S)-6-(4-fluorophenyl)-N,N-dimethyl-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2R,3R,4S)-6-(4-fluorophenyl)-N,N-dimethyl-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 11890939 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2R,3R,4S)-6-(4-fluorophenyl)-N,N-dimethyl-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | CN(C)[C@H]1C=C(c2ccc(F)cc2)S[C@H](c2cccc3ccccc23)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21FN2O2S/c1-25(2)20-14-21(16-10-12-17(24)13-11-16)29-23(22(20)26(27)28)19-9-5-7-15-6-3-4-8-18(15)19/h3-14,20,22-23H,1-2H3/t20-,22+,23+/m0/s1 |
| InChIKey | MNJXGDUELBAQKA-MDNUFGMLSA-N |
| XLogP | 5.38 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|