C25H24N2O2S — CID 7213112
(2S,3S,4S)-N,N-dimethyl-3-nitro-2,5,6-triphenyl-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 7213112) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is (2S,3S,4S)-N,N-dimethyl-3-nitro-2,5,6-triphenyl-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2S,3S,4S)-N,N-dimethyl-3-nitro-2,5,6-triphenyl-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 7213112 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2S,3S,4S)-N,N-dimethyl-3-nitro-2,5,6-triphenyl-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | CN(C)[C@H]1C(c2ccccc2)=C(c2ccccc2)S[C@@H](c2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C25H24N2O2S/c1-26(2)22-21(18-12-6-3-7-13-18)24(19-14-8-4-9-15-19)30-25(23(22)27(28)29)20-16-10-5-11-17-20/h3-17,22-23,25H,1-2H3/t22-,23-,25-/m0/s1 |
| InChIKey | RGLABPZDKNDTTA-LSQMVHIFSA-N |
| XLogP | 5.62 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|