C17H15NO2S — CID 177256291
3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran (PubChem CID 177256291) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran.
| Compound Name | 3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 177256291 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-nitro-2,6-diphenyl-3,4-dihydro-2H-thiopyran |
| SMILES | O=[N+]([O-])C1CC=C(c2ccccc2)SC1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2S/c19-18(20)15-11-12-16(13-7-3-1-4-8-13)21-17(15)14-9-5-2-6-10-14/h1-10,12,15,17H,11H2 |
| InChIKey | BDOUYMZNYQZHQS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|