C23H22FN2O2S+ — CID 11890940
[(2S,3R,4R)-6-(4-fluorophenyl)-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-yl]-dimethylazanium (PubChem CID 11890940) has the molecular formula C23H22FN2O2S+ and a molecular weight of 409.51 g/mol. Its IUPAC name is [(2S,3R,4R)-6-(4-fluorophenyl)-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-yl]-dimethylazanium.
| Compound Name | [(2S,3R,4R)-6-(4-fluorophenyl)-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-yl]-dimethylazanium |
|---|---|
| PubChem CID | 11890940 |
| Molecular Formula | C23H22FN2O2S+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [(2S,3R,4R)-6-(4-fluorophenyl)-2-naphthalen-1-yl-3-nitro-3,4-dihydro-2H-thiopyran-4-yl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H]1C=C(c2ccc(F)cc2)S[C@@H](c2cccc3ccccc23)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21FN2O2S/c1-25(2)20-14-21(16-10-12-17(24)13-11-16)29-23(22(20)26(27)28)19-9-5-7-15-6-3-4-8-18(15)19/h3-14,20,22-23H,1-2H3/p+1/t20-,22-,23+/m1/s1 |
| InChIKey | MNJXGDUELBAQKA-MZYLBHOOSA-O |
| XLogP | 3.97 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|