C24H26Cl3N3O2S — CID 91056692
1-benzhydryl-4-(3,4,4-trichloro-2-nitro-1-propylsulfanylbuta-1,3-dienyl)piperazine (PubChem CID 91056692) has the molecular formula C24H26Cl3N3O2S and a molecular weight of 526.92 g/mol. Its IUPAC name is 1-benzhydryl-4-(3,4,4-trichloro-2-nitro-1-propylsulfanylbuta-1,3-dienyl)piperazine.
| Compound Name | 1-benzhydryl-4-(3,4,4-trichloro-2-nitro-1-propylsulfanylbuta-1,3-dienyl)piperazine |
|---|---|
| PubChem CID | 91056692 |
| Molecular Formula | C24H26Cl3N3O2S |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 1-benzhydryl-4-(3,4,4-trichloro-2-nitro-1-propylsulfanylbuta-1,3-dienyl)piperazine |
| SMILES | CCCSC(=C(C(Cl)=C(Cl)Cl)[N+](=O)[O-])N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26Cl3N3O2S/c1-2-17-33-24(22(30(31)32)20(25)23(26)27)29-15-13-28(14-16-29)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,21H,2,13-17H2,1H3 |
| InChIKey | MSUHWGGWPQHYKV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|