C22H21Cl3N2O2S — CID 134920721
4-phenyl-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine (PubChem CID 134920721) has the molecular formula C22H21Cl3N2O2S and a molecular weight of 483.85 g/mol. Its IUPAC name is 4-phenyl-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine.
| Compound Name | 4-phenyl-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 134920721 |
| Molecular Formula | C22H21Cl3N2O2S |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 4-phenyl-1-[(1Z)-3,4,4-trichloro-1-(4-methylphenyl)sulfanyl-2-nitrobuta-1,3-dienyl]piperidine |
| SMILES | Cc1ccc(S/C(=C(/C(Cl)=C(Cl)Cl)[N+](=O)[O-])N2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H21Cl3N2O2S/c1-15-7-9-18(10-8-15)30-22(20(27(28)29)19(23)21(24)25)26-13-11-17(12-14-26)16-5-3-2-4-6-16/h2-10,17H,11-14H2,1H3/b22-20- |
| InChIKey | QHTDCZTZTPHPKU-XDOYNYLZSA-N |
| XLogP | 7.30 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|