C25H21Cl3N2O2S — CID 5368246
(1E)-N,N-dibenzyl-1-benzylsulfanyl-3,4,4-trichloro-2-nitrobuta-1,3-dien-1-amine (PubChem CID 5368246) has the molecular formula C25H21Cl3N2O2S and a molecular weight of 519.88 g/mol. Its IUPAC name is (1E)-N,N-dibenzyl-1-benzylsulfanyl-3,4,4-trichloro-2-nitrobuta-1,3-dien-1-amine.
| Compound Name | (1E)-N,N-dibenzyl-1-benzylsulfanyl-3,4,4-trichloro-2-nitrobuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 5368246 |
| Molecular Formula | C25H21Cl3N2O2S |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | (1E)-N,N-dibenzyl-1-benzylsulfanyl-3,4,4-trichloro-2-nitrobuta-1,3-dien-1-amine |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C(/SCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H21Cl3N2O2S/c26-22(24(27)28)23(30(31)32)25(33-18-21-14-8-3-9-15-21)29(16-19-10-4-1-5-11-19)17-20-12-6-2-7-13-20/h1-15H,16-18H2/b25-23+ |
| InChIKey | YVCFQRZAFDMWQK-WJTDDFOZSA-N |
| XLogP | 7.95 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|